C23H32O4 — CID 90801580
[2-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (PubChem CID 90801580) has the molecular formula C23H32O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is [2-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 90801580 |
| Molecular Formula | C23H32O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | [2-[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)[C@H]1CCC2C3CC=C4CC(=O)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C23H32O4/c1-14(24)27-13-21(26)20-7-6-18-17-5-4-15-12-16(25)8-10-22(15,2)19(17)9-11-23(18,20)3/h4,17-20H,5-13H2,1-3H3/t17?,18?,19?,20-,22+,23+/m1/s1 |
| InChIKey | HJMATBDGCKEHQI-CLIPTZFXSA-N |
| XLogP | 4.27 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|