C27H44INO4 — CID 10257494
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyloxymethyl-triethylazanium iodide (PubChem CID 10257494) has the molecular formula C27H44INO4 and a molecular weight of 573.56 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyloxymethyl-triethylazanium iodide.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyloxymethyl-triethylazanium iodide |
|---|---|
| PubChem CID | 10257494 |
| Molecular Formula | C27H44INO4 |
| Molecular Weight | 573.56 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyloxymethyl-triethylazanium iodide |
| SMILES | CC[N+](CC)(CC)COC(=O)O[C@H]1CC[C@H]2[C@@H]3CC=C4CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C.[I-] |
| InChI | InChI=1S/C27H44NO4.HI/c1-6-28(7-2,8-3)18-31-25(30)32-24-12-11-22-21-10-9-19-17-20(29)13-15-26(19,4)23(21)14-16-27(22,24)5;/h9,21-24H,6-8,10-18H2,1-5H3;1H/q+1;/p-1/t21-,22-,23-,24-,26-,27-;/m0./s1 |
| InChIKey | BMRUXGRFGILYPQ-KLIUNZRDSA-M |
| XLogP | 2.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|