C28H44NO4+ — CID 10054051
[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxycarbonyloxymethyl-diethyl-prop-2-enylazanium (PubChem CID 10054051) has the molecular formula C28H44NO4+ and a molecular weight of 458.66 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxycarbonyloxymethyl-diethyl-prop-2-enylazanium.
| Compound Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxycarbonyloxymethyl-diethyl-prop-2-enylazanium |
|---|---|
| PubChem CID | 10054051 |
| Molecular Formula | C28H44NO4+ |
| Molecular Weight | 458.66 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]oxycarbonyloxymethyl-diethyl-prop-2-enylazanium |
| SMILES | C=CC[N+](CC)(CC)COC(=O)O[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1 |
| InChI | InChI=1S/C28H44NO4/c1-6-17-29(7-2,8-3)19-32-26(31)33-21-13-15-27(4)20(18-21)9-10-22-23-11-12-25(30)28(23,5)16-14-24(22)27/h6,9,21-24H,1,7-8,10-19H2,2-5H3/q+1/t21-,22-,23-,24-,27-,28-/m0/s1 |
| InChIKey | HGLQNAHTTZWLQS-YPZLOKHQSA-N |
| XLogP | 6.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.66 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|