C22H33N3O3 — CID 91310588
(10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) 2-(diaminomethylideneamino)acetate (PubChem CID 91310588) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is (10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) 2-(diaminomethylideneamino)acetate.
| Compound Name | (10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) 2-(diaminomethylideneamino)acetate |
|---|---|
| PubChem CID | 91310588 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | (10,13-dimethyl-3-oxo-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl) 2-(diaminomethylideneamino)acetate |
| SMILES | CC12CCC(=O)CC1=CCC1C2CCC2(C)C(OC(=O)CN=C(N)N)CCC12 |
| InChI | InChI=1S/C22H33N3O3/c1-21-9-7-14(26)11-13(21)3-4-15-16-5-6-18(22(16,2)10-8-17(15)21)28-19(27)12-25-20(23)24/h3,15-18H,4-12H2,1-2H3,(H4,23,24,25) |
| InChIKey | PYXIAWJWLFEFPS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|