C23H36O3 — CID 90346949
(8R,9S,10R,13S,14S,17S)-10-ethyl-17-methoxy-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] (PubChem CID 90346949) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-10-ethyl-17-methoxy-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane].
| Compound Name | (8R,9S,10R,13S,14S,17S)-10-ethyl-17-methoxy-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 90346949 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-10-ethyl-17-methoxy-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane] |
| SMILES | CC[C@]12CCC3(CC1=CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](OC)CC[C@@H]12)OCCO3 |
| InChI | InChI=1S/C23H36O3/c1-4-22-11-12-23(25-13-14-26-23)15-16(22)5-6-17-18-7-8-20(24-3)21(18,2)10-9-19(17)22/h5,17-20H,4,6-15H2,1-3H3/t17-,18-,19-,20-,21-,22-/m0/s1 |
| InChIKey | TUOBKQOWNXHXKG-WLNPFYQQSA-N |
| XLogP | 5.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|