C28H34F2O4 — CID 14801344
[(8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl] benzoate (PubChem CID 14801344) has the molecular formula C28H34F2O4 and a molecular weight of 472.57 g/mol. Its IUPAC name is [(8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl] benzoate.
| Compound Name | [(8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl] benzoate |
|---|---|
| PubChem CID | 14801344 |
| Molecular Formula | C28H34F2O4 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [(8S,9S,10S,13S,14S,17S)-10-(difluoromethyl)-13-methylspiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-17-yl] benzoate |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4CC5(CC[C@@]43C(F)F)OCCO5)[C@@H]1CC[C@@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C28H34F2O4/c1-26-12-11-22-20(21(26)9-10-23(26)34-24(31)18-5-3-2-4-6-18)8-7-19-17-27(32-15-16-33-27)13-14-28(19,22)25(29)30/h2-7,20-23,25H,8-17H2,1H3/t20-,21-,22-,23-,26-,28+/m0/s1 |
| InChIKey | OQUPJSPMWNWQJE-NYSXRXLASA-N |
| XLogP | 6.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|