C23H34O5 — CID 13370497
CID 13370497 (PubChem CID 13370497) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol.
| Compound Name | CID 13370497 |
|---|---|
| PubChem CID | 13370497 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | — |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4CC5(CC[C@@]43CO)OCCO5)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C23H34O5/c1-20-6-4-19-17(18(20)5-7-23(20)27-12-13-28-23)3-2-16-14-22(25-10-11-26-22)9-8-21(16,19)15-24/h2,17-19,24H,3-15H2,1H3/t17-,18-,19-,20-,21+/m0/s1 |
| InChIKey | WZUVPYRTNFNLNJ-UQVNRYHBSA-N |
| XLogP | 3.41 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|