C27H42O5 — CID 85434738
CID 85434738 (PubChem CID 85434738) has the molecular formula C27H42O5 and a molecular weight of 446.63 g/mol.
| Compound Name | CID 85434738 |
|---|---|
| PubChem CID | 85434738 |
| Molecular Formula | C27H42O5 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.30 |
| IUPAC Name | — |
| SMILES | CCCCC1(O)CC2(C)C(CCC23OCCO3)C2CC=C3CC4(CCC3(C)C21)OCCO4 |
| InChI | InChI=1S/C27H42O5/c1-4-5-9-25(28)18-24(3)21(8-10-27(24)31-15-16-32-27)20-7-6-19-17-26(29-13-14-30-26)12-11-23(19,2)22(20)25/h6,20-22,28H,4-5,7-18H2,1-3H3 |
| InChIKey | UIMANAXZBMQUBJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|