C24H32O4 — CID 22799609
CID 22799609 (PubChem CID 22799609) has the molecular formula C24H32O4 and a molecular weight of 384.52 g/mol.
| Compound Name | CID 22799609 |
|---|---|
| PubChem CID | 22799609 |
| Molecular Formula | C24H32O4 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | — |
| SMILES | C#CC12CC[C@H]3[C@@H](CC=C4CC5(CCC43C)OCCO5)[C@@H]1CCC21OCCO1 |
| InChI | InChI=1S/C24H32O4/c1-3-22-8-6-19-18(20(22)7-9-24(22)27-14-15-28-24)5-4-17-16-23(25-12-13-26-23)11-10-21(17,19)2/h1,4,18-20H,5-16H2,2H3/t18-,19+,20+,21?,22?/m1/s1 |
| InChIKey | IMGTWCZMQNMJBF-HDWDUVDUSA-N |
| XLogP | 4.05 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|