C26H38O4 — CID 88823636
(8'R,9'S,10'R,13'S,14'S,17'S)-17'-ethynyl-17'-(1-methoxyethoxy)-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene] (PubChem CID 88823636) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is (8'R,9'S,10'R,13'S,14'S,17'S)-17'-ethynyl-17'-(1-methoxyethoxy)-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene].
| Compound Name | (8'R,9'S,10'R,13'S,14'S,17'S)-17'-ethynyl-17'-(1-methoxyethoxy)-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene] |
|---|---|
| PubChem CID | 88823636 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | (8'R,9'S,10'R,13'S,14'S,17'S)-17'-ethynyl-17'-(1-methoxyethoxy)-10',13'-dimethylspiro[1,3-dioxolane-2,3'-2,4,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene] |
| SMILES | C#C[C@@]1(OC(C)OC)CC[C@H]2[C@@H]3CC=C4CC5(CC[C@]4(C)[C@H]3CC[C@@]21C)OCCO5 |
| InChI | InChI=1S/C26H38O4/c1-6-25(30-18(2)27-5)12-10-22-20-8-7-19-17-26(28-15-16-29-26)14-13-23(19,3)21(20)9-11-24(22,25)4/h1,7,18,20-22H,8-17H2,2-5H3/t18?,20-,21+,22+,23+,24+,25-/m1/s1 |
| InChIKey | JQXVNGFMPHQBKJ-JOJSQIKQSA-N |
| XLogP | 5.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|