C21H31ClO2 — CID 11867973
(3R,8R,9S,10S,13R,14R)-3-chloro-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] (PubChem CID 11867973) has the molecular formula C21H31ClO2 and a molecular weight of 350.93 g/mol. Its IUPAC name is (3R,8R,9S,10S,13R,14R)-3-chloro-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane].
| Compound Name | (3R,8R,9S,10S,13R,14R)-3-chloro-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 11867973 |
| Molecular Formula | C21H31ClO2 |
| Molecular Weight | 350.93 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | (3R,8R,9S,10S,13R,14R)-3-chloro-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane] |
| SMILES | C[C@@]12CC[C@@H](Cl)CC1=CC[C@H]1[C@H]3CCC4(OCCO4)[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C21H31ClO2/c1-19-8-5-15(22)13-14(19)3-4-16-17(19)6-9-20(2)18(16)7-10-21(20)23-11-12-24-21/h3,15-18H,4-13H2,1-2H3/t15-,16-,17+,18-,19-,20-/m1/s1 |
| InChIKey | JWVPKJKRSPZPMN-DAUOMPHXSA-N |
| XLogP | 5.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.93 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|