C24H37F3O — CID 163732409
(7S)-3-methoxy-7,10,13-trimethyl-17-(1,1,1-trifluoropropan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 163732409) has the molecular formula C24H37F3O and a molecular weight of 398.55 g/mol. Its IUPAC name is (7S)-3-methoxy-7,10,13-trimethyl-17-(1,1,1-trifluoropropan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (7S)-3-methoxy-7,10,13-trimethyl-17-(1,1,1-trifluoropropan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 163732409 |
| Molecular Formula | C24H37F3O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.28 |
| IUPAC Name | (7S)-3-methoxy-7,10,13-trimethyl-17-(1,1,1-trifluoropropan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | COC1CCC2(C)C(=CC(C)C3C2CCC2(C)C3CCC2C(C)C(F)(F)F)C1 |
| InChI | InChI=1S/C24H37F3O/c1-14-12-16-13-17(28-5)8-10-22(16,3)20-9-11-23(4)18(15(2)24(25,26)27)6-7-19(23)21(14)20/h12,14-15,17-21H,6-11,13H2,1-5H3 |
| InChIKey | LASPPFNZMJCKHK-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|