C38H62O6 — CID 77424897
1-O-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-O-[7,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate (PubChem CID 77424897) has the molecular formula C38H62O6 and a molecular weight of 614.91 g/mol. Its IUPAC name is 1-O-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-O-[7,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate.
| Compound Name | 1-O-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-O-[7,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
|---|---|
| PubChem CID | 77424897 |
| Molecular Formula | C38H62O6 |
| Molecular Weight | 614.91 g/mol |
| Exact Mass | 614.45 |
| IUPAC Name | 1-O-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-O-[7,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] butanedioate |
| SMILES | CC(C)CCCC(C)C1CCC2C3C(C)C=C4CC(OC(=O)CCC(=O)OCC5COC(C)(C)O5)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C38H62O6/c1-24(2)10-9-11-25(3)30-12-13-31-35-26(4)20-27-21-28(16-18-37(27,7)32(35)17-19-38(30,31)8)43-34(40)15-14-33(39)41-22-29-23-42-36(5,6)44-29/h20,24-26,28-32,35H,9-19,21-23H2,1-8H3 |
| InChIKey | URKJAQODBBOCSA-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.91 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|