C31H50O5 — CID 22826218
4-[[(8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid (PubChem CID 22826218) has the molecular formula C31H50O5 and a molecular weight of 502.74 g/mol. Its IUPAC name is 4-[[(8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid.
| Compound Name | 4-[[(8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22826218 |
| Molecular Formula | C31H50O5 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.37 |
| IUPAC Name | 4-[[(8S,9S,10R,13R,14S,17R)-7-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]-4-oxobutanoic acid |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C(O)C=C4CC(OC(=O)CCC(=O)O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H50O5/c1-19(2)7-6-8-20(3)23-9-10-24-29-25(14-16-31(23,24)5)30(4)15-13-22(17-21(30)18-26(29)32)36-28(35)12-11-27(33)34/h18-20,22-26,29,32H,6-17H2,1-5H3,(H,33,34)/t20-,22?,23-,24+,25+,26?,29+,30+,31-/m1/s1 |
| InChIKey | NFOONYVFERFJJU-ZKHOBIDPSA-N |
| XLogP | 6.78 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|