C28H45F3O — CID 142317945
(3S,17R)-3,7,10,13-tetramethyl-17-(6,6,6-trifluoro-5-methylhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol (PubChem CID 142317945) has the molecular formula C28H45F3O and a molecular weight of 454.66 g/mol. Its IUPAC name is (3S,17R)-3,7,10,13-tetramethyl-17-(6,6,6-trifluoro-5-methylhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,17R)-3,7,10,13-tetramethyl-17-(6,6,6-trifluoro-5-methylhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 142317945 |
| Molecular Formula | C28H45F3O |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.34 |
| IUPAC Name | (3S,17R)-3,7,10,13-tetramethyl-17-(6,6,6-trifluoro-5-methylhexan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-ol |
| SMILES | CC1C=C2C[C@@](C)(O)CCC2(C)C2CCC3(C)C(CC[C@@H]3C(C)CCC(C)C(F)(F)F)C12 |
| InChI | InChI=1S/C28H45F3O/c1-17(7-8-19(3)28(29,30)31)21-9-10-22-24-18(2)15-20-16-25(4,32)13-14-26(20,5)23(24)11-12-27(21,22)6/h15,17-19,21-24,32H,7-14,16H2,1-6H3/t17?,18?,19?,21-,22?,23?,24?,25+,26?,27?/m1/s1 |
| InChIKey | QKDIIWLHAHWJLK-YPXOLAQHSA-N |
| XLogP | 8.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|