C27H43F3O — CID 167490027
2,16-dimethyl-15-[(2R)-6,6,6-trifluoro-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadec-8-en-5-ol (PubChem CID 167490027) has the molecular formula C27H43F3O and a molecular weight of 440.63 g/mol. Its IUPAC name is 2,16-dimethyl-15-[(2R)-6,6,6-trifluoro-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadec-8-en-5-ol.
| Compound Name | 2,16-dimethyl-15-[(2R)-6,6,6-trifluoro-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadec-8-en-5-ol |
|---|---|
| PubChem CID | 167490027 |
| Molecular Formula | C27H43F3O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 2,16-dimethyl-15-[(2R)-6,6,6-trifluoro-5-methylhexan-2-yl]tetracyclo[9.7.0.02,8.012,16]octadec-8-en-5-ol |
| SMILES | CC(CC[C@@H](C)C1CCC2C3CC=C4CCC(O)CCC4(C)C3CCC21C)C(F)(F)F |
| InChI | InChI=1S/C27H43F3O/c1-17(5-6-18(2)27(28,29)30)22-11-12-23-21-10-8-19-7-9-20(31)13-15-25(19,3)24(21)14-16-26(22,23)4/h8,17-18,20-24,31H,5-7,9-16H2,1-4H3/t17-,18?,20?,21?,22?,23?,24?,25?,26?/m1/s1 |
| InChIKey | UJTQXTSKKKGLBC-JAIRWWLLSA-N |
| XLogP | 7.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|