C26H38F6O2 — CID 58606391
(3S)-10,13-dimethyl-17-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 58606391) has the molecular formula C26H38F6O2 and a molecular weight of 496.58 g/mol. Its IUPAC name is (3S)-10,13-dimethyl-17-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S)-10,13-dimethyl-17-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 58606391 |
| Molecular Formula | C26H38F6O2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.28 |
| IUPAC Name | (3S)-10,13-dimethyl-17-[6,6,6-trifluoro-5-hydroxy-5-(trifluoromethyl)hexan-2-yl]-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | CC(CCC(O)(C(F)(F)F)C(F)(F)F)C1CCC2C3CC=C4C[C@@H](O)CCC4(C)C3CCC12C |
| InChI | InChI=1S/C26H38F6O2/c1-15(8-13-24(34,25(27,28)29)26(30,31)32)19-6-7-20-18-5-4-16-14-17(33)9-11-22(16,2)21(18)10-12-23(19,20)3/h4,15,17-21,33-34H,5-14H2,1-3H3/t15?,17-,18?,19?,20?,21?,22?,23?/m0/s1 |
| InChIKey | TZKMIYDDTDZWDJ-XYZLAVLCSA-N |
| XLogP | 7.20 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|