C28H43F3O2 — CID 169312796
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-cyclopropyl-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 169312796) has the molecular formula C28H43F3O2 and a molecular weight of 468.64 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-cyclopropyl-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-cyclopropyl-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 169312796 |
| Molecular Formula | C28H43F3O2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.32 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5-cyclopropyl-6,6,6-trifluoro-5-hydroxyhexan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CC[C@@](O)(C1CC1)C(F)(F)F)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C28H43F3O2/c1-17(10-15-27(33,18-4-5-18)28(29,30)31)22-8-9-23-21-7-6-19-16-20(32)11-13-25(19,2)24(21)12-14-26(22,23)3/h6,17-18,20-24,32-33H,4-5,7-16H2,1-3H3/t17-,20+,21+,22-,23+,24+,25+,26-,27-/m1/s1 |
| InChIKey | ACBPHQADAQRZGW-DWZUXHHLSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|