C27H40F6O — CID 88638605
(3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-(difluoromethyl)-6,7,7,7-tetrafluoroheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 88638605) has the molecular formula C27H40F6O and a molecular weight of 494.60 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-(difluoromethyl)-6,7,7,7-tetrafluoroheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-(difluoromethyl)-6,7,7,7-tetrafluoroheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 88638605 |
| Molecular Formula | C27H40F6O |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.30 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(2R)-6-(difluoromethyl)-6,7,7,7-tetrafluoroheptan-2-yl]-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@H](CCCC(F)(C(F)F)C(F)(F)F)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H40F6O/c1-16(5-4-12-26(30,23(28)29)27(31,32)33)20-8-9-21-19-7-6-17-15-18(34)10-13-24(17,2)22(19)11-14-25(20,21)3/h6,16,18-23,34H,4-5,7-15H2,1-3H3/t16-,18+,19+,20-,21+,22+,24+,25-,26?/m1/s1 |
| InChIKey | UVQTZWZNKYZNTR-OWDKWSPISA-N |
| XLogP | 8.27 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|