C27H43F3O2 — CID 176721059
(3S,10R,13R,17R)-7,7-dideuterio-3,10,13-trimethyl-17-[(2R,5S)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 176721059) has the molecular formula C27H43F3O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is (3S,10R,13R,17R)-7,7-dideuterio-3,10,13-trimethyl-17-[(2R,5S)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,10R,13R,17R)-7,7-dideuterio-3,10,13-trimethyl-17-[(2R,5S)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 176721059 |
| Molecular Formula | C27H43F3O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.33 |
| IUPAC Name | (3S,10R,13R,17R)-7,7-dideuterio-3,10,13-trimethyl-17-[(2R,5S)-6,6,6-trifluoro-5-hydroxy-5-methylhexan-2-yl]-2,4,8,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | [2H]C1([2H])C=C2C[C@@](C)(O)CC[C@]2(C)C2CC[C@@]3(C)C(CC[C@@H]3[C@H](C)CC[C@](C)(O)C(F)(F)F)C21 |
| InChI | InChI=1S/C27H43F3O2/c1-17(10-13-26(5,32)27(28,29)30)20-8-9-21-19-7-6-18-16-23(2,31)14-15-24(18,3)22(19)11-12-25(20,21)4/h6,17,19-22,31-32H,7-16H2,1-5H3/t17-,19?,20-,21?,22?,23+,24+,25-,26+/m1/s1/i7D2 |
| InChIKey | BVBRUQYHUXKZMQ-AWEHAZGZSA-N |
| XLogP | 7.05 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|