C25H39NO2 — CID 123708517
(8S,9R,10R,13S,14S)-3-hydroxy-7,10,13-trimethyl-17-piperidin-2-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one (PubChem CID 123708517) has the molecular formula C25H39NO2 and a molecular weight of 385.59 g/mol. Its IUPAC name is (8S,9R,10R,13S,14S)-3-hydroxy-7,10,13-trimethyl-17-piperidin-2-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one.
| Compound Name | (8S,9R,10R,13S,14S)-3-hydroxy-7,10,13-trimethyl-17-piperidin-2-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
|---|---|
| PubChem CID | 123708517 |
| Molecular Formula | C25H39NO2 |
| Molecular Weight | 385.59 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | (8S,9R,10R,13S,14S)-3-hydroxy-7,10,13-trimethyl-17-piperidin-2-yl-1,2,3,4,7,8,9,11,12,14,15,17-dodecahydrocyclopenta[a]phenanthren-16-one |
| SMILES | CC1C=C2CC(O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(C4CCCCN4)C(=O)C[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H39NO2/c1-15-12-16-13-17(27)7-9-24(16,2)18-8-10-25(3)19(22(15)18)14-21(28)23(25)20-6-4-5-11-26-20/h12,15,17-20,22-23,26-27H,4-11,13-14H2,1-3H3/t15?,17?,18-,19+,20?,22-,23?,24+,25+/m1/s1 |
| InChIKey | QYQUOIGTFXFNSM-HHSFSKROSA-N |
| XLogP | 4.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.59 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|