C25H31NO — CID 67225696
(8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-pyridin-3-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one (PubChem CID 67225696) has the molecular formula C25H31NO and a molecular weight of 361.53 g/mol. Its IUPAC name is (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-pyridin-3-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-pyridin-3-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 67225696 |
| Molecular Formula | C25H31NO |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | (8R,9R,10R,13S,14S)-7,10,13-trimethyl-17-pyridin-3-yl-1,2,4,7,8,9,11,12,14,15-decahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1C=C2CC(=O)CC[C@]2(C)[C@@H]2CC[C@]3(C)C(c4cccnc4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C25H31NO/c1-16-13-18-14-19(27)8-10-24(18,2)22-9-11-25(3)20(6-7-21(25)23(16)22)17-5-4-12-26-15-17/h4-6,12-13,15-16,21-23H,7-11,14H2,1-3H3/t16?,21-,22+,23-,24-,25+/m0/s1 |
| InChIKey | SWVAXZBZVQKXAD-XEWILTJVSA-N |
| XLogP | 5.85 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|