C24H30N2O2 — CID 76533427
2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene-5,7-dione (PubChem CID 76533427) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene-5,7-dione.
| Compound Name | 2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene-5,7-dione |
|---|---|
| PubChem CID | 76533427 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2,16-dimethyl-15-pyridin-3-yl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-ene-5,7-dione |
| SMILES | CC12CCC3C(CCN4C(=O)CC(=O)CCC34C)C1CC=C2c1cccnc1 |
| InChI | InChI=1S/C24H30N2O2/c1-23-10-8-21-18(20(23)6-5-19(23)16-4-3-12-25-15-16)9-13-26-22(28)14-17(27)7-11-24(21,26)2/h3-5,12,15,18,20-21H,6-11,13-14H2,1-2H3 |
| InChIKey | VRYVSGFZZNNTLY-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|