C26H35NO — CID 77405341
2,4,10,13-tetramethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one (PubChem CID 77405341) has the molecular formula C26H35NO and a molecular weight of 377.57 g/mol. Its IUPAC name is 2,4,10,13-tetramethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one.
| Compound Name | 2,4,10,13-tetramethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 77405341 |
| Molecular Formula | C26H35NO |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | 2,4,10,13-tetramethyl-17-pyridin-3-yl-1,2,4,5,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthren-3-one |
| SMILES | CC1CC2(C)C(CCC3C4CC=C(c5cccnc5)C4(C)CCC32)C(C)C1=O |
| InChI | InChI=1S/C26H35NO/c1-16-14-26(4)20(17(2)24(16)28)8-7-19-22-10-9-21(18-6-5-13-27-15-18)25(22,3)12-11-23(19)26/h5-6,9,13,15-17,19-20,22-23H,7-8,10-12,14H2,1-4H3 |
| InChIKey | JOXNHNHVAOPFIU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |