C27H38N2O — CID 76533146
N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)-N-methylacetamide (PubChem CID 76533146) has the molecular formula C27H38N2O and a molecular weight of 406.61 g/mol. Its IUPAC name is N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)-N-methylacetamide.
| Compound Name | N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 76533146 |
| Molecular Formula | C27H38N2O |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | N-(10,13-dimethyl-17-pyridin-3-yl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl)-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCC2(C)C(CCC3C4CC=C(c5cccnc5)C4(C)CCC32)C1 |
| InChI | InChI=1S/C27H38N2O/c1-18(30)29(4)21-11-13-26(2)20(16-21)7-8-22-24-10-9-23(19-6-5-15-28-17-19)27(24,3)14-12-25(22)26/h5-6,9,15,17,20-22,24-25H,7-8,10-14,16H2,1-4H3 |
| InChIKey | PFSKDVJWOZQJBX-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |