C28H40N2O — CID 77405395
N-[10,13-dimethyl-17-(5-methyl-3-pyridinyl)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylacetamide (PubChem CID 77405395) has the molecular formula C28H40N2O and a molecular weight of 420.64 g/mol. Its IUPAC name is N-[10,13-dimethyl-17-(5-methyl-3-pyridinyl)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylacetamide.
| Compound Name | N-[10,13-dimethyl-17-(5-methyl-3-pyridinyl)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 77405395 |
| Molecular Formula | C28H40N2O |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.31 |
| IUPAC Name | N-[10,13-dimethyl-17-(5-methyl-3-pyridinyl)-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]-N-methylacetamide |
| SMILES | CC(=O)N(C)C1CCC2(C)C(CCC3C4CC=C(c5cncc(C)c5)C4(C)CCC32)C1 |
| InChI | InChI=1S/C28H40N2O/c1-18-14-20(17-29-16-18)24-8-9-25-23-7-6-21-15-22(30(5)19(2)31)10-12-27(21,3)26(23)11-13-28(24,25)4/h8,14,16-17,21-23,25-26H,6-7,9-13,15H2,1-5H3 |
| InChIKey | BLBFEQACRQJDKJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |