C24H30N2O — CID 77405470
1,3a,5a-trimethyl-6-(5-methyl-3-pyridinyl)-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one (PubChem CID 77405470) has the molecular formula C24H30N2O and a molecular weight of 362.52 g/mol. Its IUPAC name is 1,3a,5a-trimethyl-6-(5-methyl-3-pyridinyl)-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one.
| Compound Name | 1,3a,5a-trimethyl-6-(5-methyl-3-pyridinyl)-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one |
|---|---|
| PubChem CID | 77405470 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 1,3a,5a-trimethyl-6-(5-methyl-3-pyridinyl)-3,3b,4,5,8,8a,8b,9-octahydroindeno[5,4-e]indol-2-one |
| SMILES | Cc1cncc(C2=CCC3C4CC=C5N(C)C(=O)CC5(C)C4CCC23C)c1 |
| InChI | InChI=1S/C24H30N2O/c1-15-11-16(14-25-13-15)18-6-7-19-17-5-8-21-24(3,12-22(27)26(21)4)20(17)9-10-23(18,19)2/h6,8,11,13-14,17,19-20H,5,7,9-10,12H2,1-4H3 |
| InChIKey | YCWOFCOUQLGHES-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |