C25H32N2O — CID 68794181
(3aS,3bS,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-1-pyridin-4-yl-3a,3b,4,8,9,9b,10,11-octahydro-3H-indeno[5,4-f]quinolin-7-one (PubChem CID 68794181) has the molecular formula C25H32N2O and a molecular weight of 376.54 g/mol. Its IUPAC name is (3aS,3bS,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-1-pyridin-4-yl-3a,3b,4,8,9,9b,10,11-octahydro-3H-indeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-1-pyridin-4-yl-3a,3b,4,8,9,9b,10,11-octahydro-3H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 68794181 |
| Molecular Formula | C25H32N2O |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | (3aS,3bS,9aR,9bS,11aS)-6-ethyl-9a,11a-dimethyl-1-pyridin-4-yl-3a,3b,4,8,9,9b,10,11-octahydro-3H-indeno[5,4-f]quinolin-7-one |
| SMILES | CCN1C(=O)CC[C@@]2(C)C1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3ccncc3)=CC[C@@H]12 |
| InChI | InChI=1S/C25H32N2O/c1-4-27-22-8-5-18-20-7-6-19(17-11-15-26-16-12-17)24(20,2)13-9-21(18)25(22,3)14-10-23(27)28/h6,8,11-12,15-16,18,20-21H,4-5,7,9-10,13-14H2,1-3H3/t18-,20-,21-,24+,25+/m0/s1 |
| InChIKey | IPVAPDBWNWKAHC-XPMKPVRUSA-N |
| XLogP | 5.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |