C26H35NO2 — CID 53311151
(1S,2S,8S,11R,12S,16S)-15-(5-ethyl-3-pyridinyl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one (PubChem CID 53311151) has the molecular formula C26H35NO2 and a molecular weight of 393.57 g/mol. Its IUPAC name is (1S,2S,8S,11R,12S,16S)-15-(5-ethyl-3-pyridinyl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one.
| Compound Name | (1S,2S,8S,11R,12S,16S)-15-(5-ethyl-3-pyridinyl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
|---|---|
| PubChem CID | 53311151 |
| Molecular Formula | C26H35NO2 |
| Molecular Weight | 393.57 g/mol |
| Exact Mass | 393.27 |
| IUPAC Name | (1S,2S,8S,11R,12S,16S)-15-(5-ethyl-3-pyridinyl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
| SMILES | CCc1cncc(C2=CC[C@H]3[C@@H]4CC[C@H]5CC(=O)OCC[C@]5(C)[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C26H35NO2/c1-4-17-13-18(16-27-15-17)21-7-8-22-20-6-5-19-14-24(28)29-12-11-25(19,2)23(20)9-10-26(21,22)3/h7,13,15-16,19-20,22-23H,4-6,8-12,14H2,1-3H3/t19-,20-,22-,23-,25-,26+/m0/s1 |
| InChIKey | NPHGBQBPAFEXLO-TZKZFTRPSA-N |
| XLogP | 5.83 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |