C25H34N2O2 — CID 53312170
(1S,2S,8S,11R,12S,16S)-15-(6-ethylpyrazin-2-yl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one (PubChem CID 53312170) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is (1S,2S,8S,11R,12S,16S)-15-(6-ethylpyrazin-2-yl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one.
| Compound Name | (1S,2S,8S,11R,12S,16S)-15-(6-ethylpyrazin-2-yl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
|---|---|
| PubChem CID | 53312170 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | (1S,2S,8S,11R,12S,16S)-15-(6-ethylpyrazin-2-yl)-2,16-dimethyl-5-oxatetracyclo[9.7.0.02,8.012,16]octadec-14-en-6-one |
| SMILES | CCc1cncc(C2=CC[C@H]3[C@@H]4CC[C@H]5CC(=O)OCC[C@]5(C)[C@H]4CC[C@]23C)n1 |
| InChI | InChI=1S/C25H34N2O2/c1-4-17-14-26-15-22(27-17)21-8-7-19-18-6-5-16-13-23(28)29-12-11-24(16,2)20(18)9-10-25(19,21)3/h8,14-16,18-20H,4-7,9-13H2,1-3H3/t16-,18-,19-,20-,24-,25-/m0/s1 |
| InChIKey | LJERAHIYSJNNTJ-LNTIOWCSSA-N |
| XLogP | 5.23 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |