C25H42N2O — CID 162860563
N-[(1S)-1-[(3R,5S,8R,9S,10S,13S,14S)-3-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-N-methylformamide (PubChem CID 162860563) has the molecular formula C25H42N2O and a molecular weight of 386.62 g/mol. Its IUPAC name is N-[(1S)-1-[(3R,5S,8R,9S,10S,13S,14S)-3-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-N-methylformamide.
| Compound Name | N-[(1S)-1-[(3R,5S,8R,9S,10S,13S,14S)-3-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-N-methylformamide |
|---|---|
| PubChem CID | 162860563 |
| Molecular Formula | C25H42N2O |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.33 |
| IUPAC Name | N-[(1S)-1-[(3R,5S,8R,9S,10S,13S,14S)-3-(dimethylamino)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethyl]-N-methylformamide |
| SMILES | C[C@@H](C1=CC[C@H]2[C@@H]3CC[C@H]4C[C@H](N(C)C)CC[C@]4(C)[C@H]3CC[C@]12C)N(C)C=O |
| InChI | InChI=1S/C25H42N2O/c1-17(27(6)16-28)21-9-10-22-20-8-7-18-15-19(26(4)5)11-13-24(18,2)23(20)12-14-25(21,22)3/h9,16-20,22-23H,7-8,10-15H2,1-6H3/t17-,18-,19+,20-,22-,23-,24-,25+/m0/s1 |
| InChIKey | KKDRMOLJBBQZAY-KLPNOZIVSA-N |
| XLogP | 4.97 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|