C29H48O4 — CID 59052578
(3S,5S,8R,9S,10S,13S,14S)-17-[(1S)-1-[2-[(3R)-4-hydroxy-3-methylbutyl]-1,3-dioxolan-2-yl]ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 59052578) has the molecular formula C29H48O4 and a molecular weight of 460.70 g/mol. Its IUPAC name is (3S,5S,8R,9S,10S,13S,14S)-17-[(1S)-1-[2-[(3R)-4-hydroxy-3-methylbutyl]-1,3-dioxolan-2-yl]ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3S,5S,8R,9S,10S,13S,14S)-17-[(1S)-1-[2-[(3R)-4-hydroxy-3-methylbutyl]-1,3-dioxolan-2-yl]ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 59052578 |
| Molecular Formula | C29H48O4 |
| Molecular Weight | 460.70 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | (3S,5S,8R,9S,10S,13S,14S)-17-[(1S)-1-[2-[(3R)-4-hydroxy-3-methylbutyl]-1,3-dioxolan-2-yl]ethyl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C[C@@H](CO)CCC1([C@@H](C)C2=CC[C@H]3[C@@H]4CC[C@H]5C[C@@H](O)CC[C@]5(C)[C@H]4CC[C@]23C)OCCO1 |
| InChI | InChI=1S/C29H48O4/c1-19(18-30)9-14-29(32-15-16-33-29)20(2)24-7-8-25-23-6-5-21-17-22(31)10-12-27(21,3)26(23)11-13-28(24,25)4/h7,19-23,25-26,30-31H,5-6,8-18H2,1-4H3/t19-,20+,21+,22+,23+,25+,26+,27+,28-/m1/s1 |
| InChIKey | LPQULOJHJSZIBE-DABNFLOZSA-N |
| XLogP | 5.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.70 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|