C25H35N — CID 122644566
3-[(3S,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine (PubChem CID 122644566) has the molecular formula C25H35N and a molecular weight of 349.56 g/mol. Its IUPAC name is 3-[(3S,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine.
| Compound Name | 3-[(3S,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine |
|---|---|
| PubChem CID | 122644566 |
| Molecular Formula | C25H35N |
| Molecular Weight | 349.56 g/mol |
| Exact Mass | 349.28 |
| IUPAC Name | 3-[(3S,10S,13S)-3,10,13-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pyridine |
| SMILES | C[C@H]1CC[C@@]2(C)C(CCC3C2CC[C@]2(C)C(c4cccnc4)=CCC32)C1 |
| InChI | InChI=1S/C25H35N/c1-17-10-12-24(2)19(15-17)6-7-20-22-9-8-21(18-5-4-14-26-16-18)25(22,3)13-11-23(20)24/h4-5,8,14,16-17,19-20,22-23H,6-7,9-13,15H2,1-3H3/t17-,19?,20?,22?,23?,24-,25+/m0/s1 |
| InChIKey | DHZYEHSVZIAIMX-FPOPRQLCSA-N |
| XLogP | 6.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.56 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |