C32H44N2 — CID 153335338
17-isoquinolin-7-yl-N,10,13-trimethyl-N-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 153335338) has the molecular formula C32H44N2 and a molecular weight of 456.72 g/mol. Its IUPAC name is 17-isoquinolin-7-yl-N,10,13-trimethyl-N-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | 17-isoquinolin-7-yl-N,10,13-trimethyl-N-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 153335338 |
| Molecular Formula | C32H44N2 |
| Molecular Weight | 456.72 g/mol |
| Exact Mass | 456.35 |
| IUPAC Name | 17-isoquinolin-7-yl-N,10,13-trimethyl-N-prop-1-en-2-yl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | C=C(C)N(C)C1CCC2(C)C(CCC3C2CCC2(C)C(c4ccc5ccncc5c4)CCC32)C1 |
| InChI | InChI=1S/C32H44N2/c1-21(2)34(5)26-12-15-31(3)25(19-26)8-9-27-29-11-10-28(32(29,4)16-13-30(27)31)23-7-6-22-14-17-33-20-24(22)18-23/h6-7,14,17-18,20,25-30H,1,8-13,15-16,19H2,2-5H3 |
| InChIKey | MOHBPRJQXZSIPQ-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.72 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |