C23H29ClN2O — CID 53312258
(2R,10S,11S,15S)-14-(4-chloro-3-pyridinyl)-2,15-dimethyl-6-azatetracyclo[8.7.0.02,6.011,15]heptadec-13-en-7-one (PubChem CID 53312258) has the molecular formula C23H29ClN2O and a molecular weight of 384.95 g/mol. Its IUPAC name is (2R,10S,11S,15S)-14-(4-chloro-3-pyridinyl)-2,15-dimethyl-6-azatetracyclo[8.7.0.02,6.011,15]heptadec-13-en-7-one.
| Compound Name | (2R,10S,11S,15S)-14-(4-chloro-3-pyridinyl)-2,15-dimethyl-6-azatetracyclo[8.7.0.02,6.011,15]heptadec-13-en-7-one |
|---|---|
| PubChem CID | 53312258 |
| Molecular Formula | C23H29ClN2O |
| Molecular Weight | 384.95 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (2R,10S,11S,15S)-14-(4-chloro-3-pyridinyl)-2,15-dimethyl-6-azatetracyclo[8.7.0.02,6.011,15]heptadec-13-en-7-one |
| SMILES | C[C@]12CCC3[C@@H](CCC(=O)N4CCC[C@]34C)[C@@H]1CC=C2c1cnccc1Cl |
| InChI | InChI=1S/C23H29ClN2O/c1-22-11-8-19-15(4-7-21(27)26-13-3-10-23(19,26)2)17(22)5-6-18(22)16-14-25-12-9-20(16)24/h6,9,12,14-15,17,19H,3-5,7-8,10-11,13H2,1-2H3/t15-,17-,19?,22-,23+/m0/s1 |
| InChIKey | JLQPHVFZQWGFMT-RRRSCKBTSA-N |
| XLogP | 5.35 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.95 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |