C26H34N2O — CID 57386693
(2R,11S,12S,16S)-15-(5-ethenyl-3-pyridinyl)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one (PubChem CID 57386693) has the molecular formula C26H34N2O and a molecular weight of 390.57 g/mol. Its IUPAC name is (2R,11S,12S,16S)-15-(5-ethenyl-3-pyridinyl)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one.
| Compound Name | (2R,11S,12S,16S)-15-(5-ethenyl-3-pyridinyl)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one |
|---|---|
| PubChem CID | 57386693 |
| Molecular Formula | C26H34N2O |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | (2R,11S,12S,16S)-15-(5-ethenyl-3-pyridinyl)-2,16-dimethyl-8-azatetracyclo[9.7.0.02,8.012,16]octadec-14-en-7-one |
| SMILES | C=Cc1cncc(C2=CC[C@H]3[C@@H]4CCN5C(=O)CCCC[C@]5(C)C4CC[C@]23C)c1 |
| InChI | InChI=1S/C26H34N2O/c1-4-18-15-19(17-27-16-18)21-8-9-22-20-11-14-28-24(29)7-5-6-12-26(28,3)23(20)10-13-25(21,22)2/h4,8,15-17,20,22-23H,1,5-7,9-14H2,2-3H3/t20-,22-,23?,25+,26+/m0/s1 |
| InChIKey | MUEQTQMBHCWRML-PEVAOPQMSA-N |
| XLogP | 5.73 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |