C24H32N2O — CID 67246159
(8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrimidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol (PubChem CID 67246159) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrimidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol.
| Compound Name | (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrimidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
|---|---|
| PubChem CID | 67246159 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | (8S,9S,10R,13S,14S)-7,10,13-trimethyl-17-pyrimidin-2-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-1-ol |
| SMILES | CC1C=C2CCCC(O)[C@]2(C)[C@H]2CC[C@]3(C)C(c4ncccn4)=CC[C@H]3[C@H]12 |
| InChI | InChI=1S/C24H32N2O/c1-15-14-16-6-4-7-20(27)24(16,3)18-10-11-23(2)17(21(15)18)8-9-19(23)22-25-12-5-13-26-22/h5,9,12-15,17-18,20-21,27H,4,6-8,10-11H2,1-3H3/t15?,17-,18-,20?,21-,23-,24-/m0/s1 |
| InChIKey | BGVLBSBWTDTSLK-VISSEQPPSA-N |
| XLogP | 5.04 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|