C13H24N2O2 — CID 113246114
(4,4-dimethylazepan-1-yl)-morpholin-4-ylmethanone (PubChem CID 113246114) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is (4,4-dimethylazepan-1-yl)-morpholin-4-ylmethanone.
| Compound Name | (4,4-dimethylazepan-1-yl)-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 113246114 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | (4,4-dimethylazepan-1-yl)-morpholin-4-ylmethanone |
| SMILES | CC1(C)CCCN(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C13H24N2O2/c1-13(2)4-3-6-14(7-5-13)12(16)15-8-10-17-11-9-15/h3-11H2,1-2H3 |
| InChIKey | DVPJLICAOWSEIT-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |