C12H21N3O3 — CID 154703363
1-[4-(1,4-oxazepane-4-carbonyl)piperazin-1-yl]ethanone (PubChem CID 154703363) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 1-[4-(1,4-oxazepane-4-carbonyl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(1,4-oxazepane-4-carbonyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 154703363 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-[4-(1,4-oxazepane-4-carbonyl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(C(=O)N2CCCOCC2)CC1 |
| InChI | InChI=1S/C12H21N3O3/c1-11(16)13-4-6-15(7-5-13)12(17)14-3-2-9-18-10-8-14/h2-10H2,1H3 |
| InChIKey | WPVJAGLMXQWGMY-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |