C15H27NO — CID 134859807
3-(2,2-dimethylpropyl)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydroindol-2-one (PubChem CID 134859807) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydroindol-2-one.
| Compound Name | 3-(2,2-dimethylpropyl)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydroindol-2-one |
|---|---|
| PubChem CID | 134859807 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-1,3-dimethyl-3a,4,5,6,7,7a-hexahydroindol-2-one |
| SMILES | CN1C(=O)C(C)(CC(C)(C)C)C2CCCCC21 |
| InChI | InChI=1S/C15H27NO/c1-14(2,3)10-15(4)11-8-6-7-9-12(11)16(5)13(15)17/h11-12H,6-10H2,1-5H3 |
| InChIKey | ZMJNMOAEXHNOHB-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |