C10H17NO3 — CID 21358749
2-(nitromethyl)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ol (PubChem CID 21358749) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-(nitromethyl)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ol.
| Compound Name | 2-(nitromethyl)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ol |
|---|---|
| PubChem CID | 21358749 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-(nitromethyl)-1,3,3a,4,5,6,7,7a-octahydroinden-2-ol |
| SMILES | O=[N+]([O-])CC1(O)CC2CCCCC2C1 |
| InChI | InChI=1S/C10H17NO3/c12-10(7-11(13)14)5-8-3-1-2-4-9(8)6-10/h8-9,12H,1-7H2 |
| InChIKey | MENJQAKKWVWDKA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|