About nitromethylcycloheptane
nitromethylcycloheptane (PubChem CID 15584171) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is nitromethylcycloheptane.
Molecular Properties
| Compound Name | nitromethylcycloheptane |
| PubChem CID | 15584171 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | nitromethylcycloheptane |
| SMILES | O=[N+]([O-])CC1CCCCCC1 |
| InChI | InChI=1S/C8H15NO2/c10-9(11)7-8-5-3-1-2-4-6-8/h8H,1-7H2 |
| InChIKey | JBGAUEXKEXCFOQ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitromethylcycloheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitromethylcycloheptane?
The IUPAC name of nitromethylcycloheptane (CID 15584171) is nitromethylcycloheptane.
What is the SMILES notation for nitromethylcycloheptane?
The canonical SMILES for nitromethylcycloheptane is O=[N+]([O-])CC1CCCCCC1.
What is the InChIKey of nitromethylcycloheptane?
The InChIKey is JBGAUEXKEXCFOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c10-9(11)7-8-5-3-1-2-4-6-8/h8H,1-7H2.
What are the key properties of nitromethylcycloheptane?
nitromethylcycloheptane has a molecular weight of 157.21 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitromethylcycloheptane is sourced from PubChem (CID 15584171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).