C5H9NO4S — CID 7298984
(3S)-3-(nitromethyl)thiolane 1,1-dioxide (PubChem CID 7298984) has the molecular formula C5H9NO4S and a molecular weight of 179.20 g/mol. Its IUPAC name is (3S)-3-(nitromethyl)thiolane 1,1-dioxide.
| Compound Name | (3S)-3-(nitromethyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 7298984 |
| Molecular Formula | C5H9NO4S |
| Molecular Weight | 179.20 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | (3S)-3-(nitromethyl)thiolane 1,1-dioxide |
| SMILES | O=[N+]([O-])C[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C5H9NO4S/c7-6(8)3-5-1-2-11(9,10)4-5/h5H,1-4H2/t5-/m0/s1 |
| InChIKey | CWRINNZCUJIOSC-YFKPBYRVSA-N |
| XLogP | -0.30 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.20 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|