C10H16O3S — CID 105112489
1-(1,1-dioxothiolan-3-yl)-4-methylpent-4-en-2-one (PubChem CID 105112489) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-4-methylpent-4-en-2-one.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpent-4-en-2-one |
|---|---|
| PubChem CID | 105112489 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-4-methylpent-4-en-2-one |
| SMILES | C=C(C)CC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H16O3S/c1-8(2)5-10(11)6-9-3-4-14(12,13)7-9/h9H,1,3-7H2,2H3 |
| InChIKey | WJKRZMVQODOKLB-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|