C9H16O4S — CID 105114648
1-(1,1-dioxothiolan-3-yl)-3-ethoxypropan-2-one (PubChem CID 105114648) has the molecular formula C9H16O4S and a molecular weight of 220.29 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-ethoxypropan-2-one.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-ethoxypropan-2-one |
|---|---|
| PubChem CID | 105114648 |
| Molecular Formula | C9H16O4S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-ethoxypropan-2-one |
| SMILES | CCOCC(=O)CC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16O4S/c1-2-13-6-9(10)5-8-3-4-14(11,12)7-8/h8H,2-7H2,1H3 |
| InChIKey | XLCPZBKZVFRHQJ-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |