C6H11NO4S — CID 105446926
3-(2-nitroethyl)thiolane 1,1-dioxide (PubChem CID 105446926) has the molecular formula C6H11NO4S and a molecular weight of 193.22 g/mol. Its IUPAC name is 3-(2-nitroethyl)thiolane 1,1-dioxide.
| Compound Name | 3-(2-nitroethyl)thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 105446926 |
| Molecular Formula | C6H11NO4S |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.04 |
| IUPAC Name | 3-(2-nitroethyl)thiolane 1,1-dioxide |
| SMILES | O=[N+]([O-])CCC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C6H11NO4S/c8-7(9)3-1-6-2-4-12(10,11)5-6/h6H,1-5H2 |
| InChIKey | SREDIYBLSPWKAY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|