C8H15NO4S — CID 105477643
3-(2-nitropropyl)thiane 1,1-dioxide (PubChem CID 105477643) has the molecular formula C8H15NO4S and a molecular weight of 221.28 g/mol. Its IUPAC name is 3-(2-nitropropyl)thiane 1,1-dioxide.
| Compound Name | 3-(2-nitropropyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 105477643 |
| Molecular Formula | C8H15NO4S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3-(2-nitropropyl)thiane 1,1-dioxide |
| SMILES | CC(CC1CCCS(=O)(=O)C1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO4S/c1-7(9(10)11)5-8-3-2-4-14(12,13)6-8/h7-8H,2-6H2,1H3 |
| InChIKey | TXZUCJXJUUECDC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|