C7H13NO4S — CID 105460330
4-(1-nitroethyl)thiane 1,1-dioxide (PubChem CID 105460330) has the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. Its IUPAC name is 4-(1-nitroethyl)thiane 1,1-dioxide.
| Compound Name | 4-(1-nitroethyl)thiane 1,1-dioxide |
|---|---|
| PubChem CID | 105460330 |
| Molecular Formula | C7H13NO4S |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 4-(1-nitroethyl)thiane 1,1-dioxide |
| SMILES | CC(C1CCS(=O)(=O)CC1)[N+](=O)[O-] |
| InChI | InChI=1S/C7H13NO4S/c1-6(8(9)10)7-2-4-13(11,12)5-3-7/h6-7H,2-5H2,1H3 |
| InChIKey | HRACWICRGWKHNO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|