About (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine
(2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine (PubChem CID 124880904) has the molecular formula C12H25NO2S2
and a molecular weight of 279.47 g/mol. Its IUPAC name is (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine.
Molecular Properties
| Compound Name | (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine |
| PubChem CID | 124880904 |
| Molecular Formula | C12H25NO2S2 |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.13 |
| IUPAC Name | (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine |
| SMILES | CSCC[C@H](C)N(C)C[C@H]1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H25NO2S2/c1-11(6-7-16-3)13(2)9-12-5-4-8-17(14,15)10-12/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1 |
| InChIKey | VAOQNVHZUJWKBJ-NWDGAFQWSA-N |
| XLogP | 1.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The IUPAC name of (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine (CID 124880904) is (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine.
What is the SMILES notation for (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The canonical SMILES for (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine is CSCC[C@H](C)N(C)C[C@H]1CCCS(=O)(=O)C1.
What is the InChIKey of (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
The InChIKey is VAOQNVHZUJWKBJ-NWDGAFQWSA-N. The full InChI is InChI=1S/C12H25NO2S2/c1-11(6-7-16-3)13(2)9-12-5-4-8-17(14,15)10-12/h11-12H,4-10H2,1-3H3/t11-,12+/m0/s1.
What are the key properties of (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine?
(2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine has a molecular weight of 279.47 g/mol, XLogP of 1.88, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[[(3R)-1,1-dioxothian-3-yl]methyl]-N-methyl-4-methylsulfanylbutan-2-amine is sourced from PubChem (CID 124880904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).