C12H15BrN2O4S — CID 103269379
2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-5-methyl-4-nitroaniline (PubChem CID 103269379) has the molecular formula C12H15BrN2O4S and a molecular weight of 363.23 g/mol. Its IUPAC name is 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-5-methyl-4-nitroaniline.
| Compound Name | 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-5-methyl-4-nitroaniline |
|---|---|
| PubChem CID | 103269379 |
| Molecular Formula | C12H15BrN2O4S |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.99 |
| IUPAC Name | 2-bromo-N-[(1,1-dioxothiolan-3-yl)methyl]-5-methyl-4-nitroaniline |
| SMILES | Cc1cc(NCC2CCS(=O)(=O)C2)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H15BrN2O4S/c1-8-4-11(10(13)5-12(8)15(16)17)14-6-9-2-3-20(18,19)7-9/h4-5,9,14H,2-3,6-7H2,1H3 |
| InChIKey | MSQJJLOHFJKLAE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|